C19H21ClFNO3 — CID 112792591
3-chloro-N-[(4-fluorophenyl)methyl]-5-methoxy-N-methyl-4-propoxybenzamide (PubChem CID 112792591) has the molecular formula C19H21ClFNO3 and a molecular weight of 365.83 g/mol. Its IUPAC name is 3-chloro-N-[(4-fluorophenyl)methyl]-5-methoxy-N-methyl-4-propoxybenzamide.
| Compound Name | 3-chloro-N-[(4-fluorophenyl)methyl]-5-methoxy-N-methyl-4-propoxybenzamide |
|---|---|
| PubChem CID | 112792591 |
| Molecular Formula | C19H21ClFNO3 |
| Molecular Weight | 365.83 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-chloro-N-[(4-fluorophenyl)methyl]-5-methoxy-N-methyl-4-propoxybenzamide |
| SMILES | CCCOc1c(Cl)cc(C(=O)N(C)Cc2ccc(F)cc2)cc1OC |
| InChI | InChI=1S/C19H21ClFNO3/c1-4-9-25-18-16(20)10-14(11-17(18)24-3)19(23)22(2)12-13-5-7-15(21)8-6-13/h5-8,10-11H,4,9,12H2,1-3H3 |
| InChIKey | UQXYDSLDIQGABN-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.83 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |