C21H26FNO3 — CID 55358457
N-[(4-fluorophenyl)methyl]-N-methyl-3,4-dipropoxybenzamide (PubChem CID 55358457) has the molecular formula C21H26FNO3 and a molecular weight of 359.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-methyl-3,4-dipropoxybenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-methyl-3,4-dipropoxybenzamide |
|---|---|
| PubChem CID | 55358457 |
| Molecular Formula | C21H26FNO3 |
| Molecular Weight | 359.44 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-methyl-3,4-dipropoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)N(C)Cc2ccc(F)cc2)cc1OCCC |
| InChI | InChI=1S/C21H26FNO3/c1-4-12-25-19-11-8-17(14-20(19)26-13-5-2)21(24)23(3)15-16-6-9-18(22)10-7-16/h6-11,14H,4-5,12-13,15H2,1-3H3 |
| InChIKey | URWHQJGAZDFXGH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |