C17H18FNO — CID 78771211
N-[(4-fluorophenyl)methyl]-N,3,5-trimethylbenzamide (PubChem CID 78771211) has the molecular formula C17H18FNO and a molecular weight of 271.34 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N,3,5-trimethylbenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N,3,5-trimethylbenzamide |
|---|---|
| PubChem CID | 78771211 |
| Molecular Formula | C17H18FNO |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N,3,5-trimethylbenzamide |
| SMILES | Cc1cc(C)cc(C(=O)N(C)Cc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C17H18FNO/c1-12-8-13(2)10-15(9-12)17(20)19(3)11-14-4-6-16(18)7-5-14/h4-10H,11H2,1-3H3 |
| InChIKey | MAUVUFRSPMFIAK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |