C16H14FN3O5 — CID 78770425
N-[(4-fluorophenyl)methyl]-N,4-dimethyl-3,5-dinitrobenzamide (PubChem CID 78770425) has the molecular formula C16H14FN3O5 and a molecular weight of 347.30 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N,4-dimethyl-3,5-dinitrobenzamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N,4-dimethyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 78770425 |
| Molecular Formula | C16H14FN3O5 |
| Molecular Weight | 347.30 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N,4-dimethyl-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)N(C)Cc2ccc(F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14FN3O5/c1-10-14(19(22)23)7-12(8-15(10)20(24)25)16(21)18(2)9-11-3-5-13(17)6-4-11/h3-8H,9H2,1-2H3 |
| InChIKey | VRAZWHHTQUJYMG-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|