C17H14F3N3O5 — CID 31184802
N,4-dimethyl-3,5-dinitro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide (PubChem CID 31184802) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is N,4-dimethyl-3,5-dinitro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide.
| Compound Name | N,4-dimethyl-3,5-dinitro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 31184802 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | N,4-dimethyl-3,5-dinitro-N-[[4-(trifluoromethyl)phenyl]methyl]benzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)N(C)Cc2ccc(C(F)(F)F)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H14F3N3O5/c1-10-14(22(25)26)7-12(8-15(10)23(27)28)16(24)21(2)9-11-3-5-13(6-4-11)17(18,19)20/h3-8H,9H2,1-2H3 |
| InChIKey | OEIUHIKPSGYXDC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|