C15H13Cl2FN2O — CID 82781126
4-amino-3,5-dichloro-N-[(4-fluorophenyl)methyl]-N-methylbenzamide (PubChem CID 82781126) has the molecular formula C15H13Cl2FN2O and a molecular weight of 327.19 g/mol. Its IUPAC name is 4-amino-3,5-dichloro-N-[(4-fluorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 4-amino-3,5-dichloro-N-[(4-fluorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 82781126 |
| Molecular Formula | C15H13Cl2FN2O |
| Molecular Weight | 327.19 g/mol |
| Exact Mass | 326.04 |
| IUPAC Name | 4-amino-3,5-dichloro-N-[(4-fluorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(F)cc1)C(=O)c1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl2FN2O/c1-20(8-9-2-4-11(18)5-3-9)15(21)10-6-12(16)14(19)13(17)7-10/h2-7H,8,19H2,1H3 |
| InChIKey | WWMWRFPTVDPPAX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.19 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|