C15H13Cl3N2O — CID 61118649
3-amino-4,5-dichloro-N-[(4-chlorophenyl)methyl]-N-methylbenzamide (PubChem CID 61118649) has the molecular formula C15H13Cl3N2O and a molecular weight of 343.64 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-[(4-chlorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 3-amino-4,5-dichloro-N-[(4-chlorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 61118649 |
| Molecular Formula | C15H13Cl3N2O |
| Molecular Weight | 343.64 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-amino-4,5-dichloro-N-[(4-chlorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)cc1)C(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H13Cl3N2O/c1-20(8-9-2-4-11(16)5-3-9)15(21)10-6-12(17)14(18)13(19)7-10/h2-7H,8,19H2,1H3 |
| InChIKey | WOYBZXQVMVWWHY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.64 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|