C14H14Cl2N2O2 — CID 61426755
3-amino-4,5-dichloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzamide (PubChem CID 61426755) has the molecular formula C14H14Cl2N2O2 and a molecular weight of 313.18 g/mol. Its IUPAC name is 3-amino-4,5-dichloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzamide.
| Compound Name | 3-amino-4,5-dichloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 61426755 |
| Molecular Formula | C14H14Cl2N2O2 |
| Molecular Weight | 313.18 g/mol |
| Exact Mass | 312.04 |
| IUPAC Name | 3-amino-4,5-dichloro-N-methyl-N-[(2-methylfuran-3-yl)methyl]benzamide |
| SMILES | Cc1occc1CN(C)C(=O)c1cc(N)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N2O2/c1-8-9(3-4-20-8)7-18(2)14(19)10-5-11(15)13(16)12(17)6-10/h3-6H,7,17H2,1-2H3 |
| InChIKey | COFKCGDJIOOTNN-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.18 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|