C16H20N2O2 — CID 102705344
5-amino-N,2,4-trimethyl-N-[(2-methylfuran-3-yl)methyl]benzamide (PubChem CID 102705344) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-amino-N,2,4-trimethyl-N-[(2-methylfuran-3-yl)methyl]benzamide.
| Compound Name | 5-amino-N,2,4-trimethyl-N-[(2-methylfuran-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 102705344 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-amino-N,2,4-trimethyl-N-[(2-methylfuran-3-yl)methyl]benzamide |
| SMILES | Cc1cc(C)c(C(=O)N(C)Cc2ccoc2C)cc1N |
| InChI | InChI=1S/C16H20N2O2/c1-10-7-11(2)15(17)8-14(10)16(19)18(4)9-13-5-6-20-12(13)3/h5-8H,9,17H2,1-4H3 |
| InChIKey | JFIYGSNSYIRCQL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|