C16H16Cl2N2O — CID 60938287
3-amino-N-[(3,4-dichlorophenyl)methyl]-N,4-dimethylbenzamide (PubChem CID 60938287) has the molecular formula C16H16Cl2N2O and a molecular weight of 323.22 g/mol. Its IUPAC name is 3-amino-N-[(3,4-dichlorophenyl)methyl]-N,4-dimethylbenzamide.
| Compound Name | 3-amino-N-[(3,4-dichlorophenyl)methyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 60938287 |
| Molecular Formula | C16H16Cl2N2O |
| Molecular Weight | 323.22 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 3-amino-N-[(3,4-dichlorophenyl)methyl]-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)Cc2ccc(Cl)c(Cl)c2)cc1N |
| InChI | InChI=1S/C16H16Cl2N2O/c1-10-3-5-12(8-15(10)19)16(21)20(2)9-11-4-6-13(17)14(18)7-11/h3-8H,9,19H2,1-2H3 |
| InChIKey | ODAPBYMSTYCVTG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.22 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|