C16H15Cl2NO — CID 112792499
N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylbenzamide (PubChem CID 112792499) has the molecular formula C16H15Cl2NO and a molecular weight of 308.21 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylbenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylbenzamide |
|---|---|
| PubChem CID | 112792499 |
| Molecular Formula | C16H15Cl2NO |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylbenzamide |
| SMILES | Cc1ccccc1C(=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H15Cl2NO/c1-11-5-3-4-6-13(11)16(20)19(2)10-12-7-8-14(17)15(18)9-12/h3-9H,10H2,1-2H3 |
| InChIKey | GMGQPMIWXNHORU-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |