C16H15Cl2NO3S — CID 18081456
N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-methylsulfonylbenzamide (PubChem CID 18081456) has the molecular formula C16H15Cl2NO3S and a molecular weight of 372.27 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-methylsulfonylbenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 18081456 |
| Molecular Formula | C16H15Cl2NO3S |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.01 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-methyl-2-methylsulfonylbenzamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1ccccc1S(C)(=O)=O |
| InChI | InChI=1S/C16H15Cl2NO3S/c1-19(10-11-7-8-13(17)14(18)9-11)16(20)12-5-3-4-6-15(12)23(2,21)22/h3-9H,10H2,1-2H3 |
| InChIKey | ILVRRVQNQWQMSA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |