C16H15Cl2N3O2 — CID 26069791
4-(carbamoylamino)-N-[(3,4-dichlorophenyl)methyl]-N-methylbenzamide (PubChem CID 26069791) has the molecular formula C16H15Cl2N3O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-[(3,4-dichlorophenyl)methyl]-N-methylbenzamide.
| Compound Name | 4-(carbamoylamino)-N-[(3,4-dichlorophenyl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 26069791 |
| Molecular Formula | C16H15Cl2N3O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 4-(carbamoylamino)-N-[(3,4-dichlorophenyl)methyl]-N-methylbenzamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O2/c1-21(9-10-2-7-13(17)14(18)8-10)15(22)11-3-5-12(6-4-11)20-16(19)23/h2-8H,9H2,1H3,(H3,19,20,23) |
| InChIKey | FMKKNLRORIVVHT-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |