C17H16Cl2N4O3 — CID 30091289
4-(carbamoylamino)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 30091289) has the molecular formula C17H16Cl2N4O3 and a molecular weight of 395.25 g/mol. Its IUPAC name is 4-(carbamoylamino)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 4-(carbamoylamino)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 30091289 |
| Molecular Formula | C17H16Cl2N4O3 |
| Molecular Weight | 395.25 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | 4-(carbamoylamino)-N-[2-(3,4-dichloroanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(NC(N)=O)cc1 |
| InChI | InChI=1S/C17H16Cl2N4O3/c1-23(9-15(24)21-12-6-7-13(18)14(19)8-12)16(25)10-2-4-11(5-3-10)22-17(20)26/h2-8H,9H2,1H3,(H,21,24)(H3,20,22,26) |
| InChIKey | LLPPCFXEFOODRG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |