C16H13Cl2IN2O2 — CID 31182819
N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-iodo-N-methylbenzamide (PubChem CID 31182819) has the molecular formula C16H13Cl2IN2O2 and a molecular weight of 463.10 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-iodo-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 31182819 |
| Molecular Formula | C16H13Cl2IN2O2 |
| Molecular Weight | 463.10 g/mol |
| Exact Mass | 461.94 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-4-iodo-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H13Cl2IN2O2/c1-21(16(23)10-2-4-11(19)5-3-10)9-15(22)20-12-6-7-13(17)14(18)8-12/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | GOILULWOQXMREE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.10 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|