C16H12Cl2F2N2O2 — CID 2502921
N-[2-(3,4-dichloroanilino)-2-oxoethyl]-2,4-difluoro-N-methylbenzamide (PubChem CID 2502921) has the molecular formula C16H12Cl2F2N2O2 and a molecular weight of 373.19 g/mol. Its IUPAC name is N-[2-(3,4-dichloroanilino)-2-oxoethyl]-2,4-difluoro-N-methylbenzamide.
| Compound Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-2,4-difluoro-N-methylbenzamide |
|---|---|
| PubChem CID | 2502921 |
| Molecular Formula | C16H12Cl2F2N2O2 |
| Molecular Weight | 373.19 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | N-[2-(3,4-dichloroanilino)-2-oxoethyl]-2,4-difluoro-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(Cl)c(Cl)c1)C(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C16H12Cl2F2N2O2/c1-22(16(24)11-4-2-9(19)6-14(11)20)8-15(23)21-10-3-5-12(17)13(18)7-10/h2-7H,8H2,1H3,(H,21,23) |
| InChIKey | PNMSIKWGWQBZQT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.19 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |