C16H13Cl2FN2O2 — CID 18112706
2,3-dichloro-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 18112706) has the molecular formula C16H13Cl2FN2O2 and a molecular weight of 355.20 g/mol. Its IUPAC name is 2,3-dichloro-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 2,3-dichloro-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 18112706 |
| Molecular Formula | C16H13Cl2FN2O2 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2,3-dichloro-N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H13Cl2FN2O2/c1-21(16(23)12-3-2-4-13(17)15(12)18)9-14(22)20-11-7-5-10(19)6-8-11/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | GTEYJYYRUKKSPB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |