C16H14FN3O4 — CID 18112696
N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-2-nitrobenzamide (PubChem CID 18112696) has the molecular formula C16H14FN3O4 and a molecular weight of 331.30 g/mol. Its IUPAC name is N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-2-nitrobenzamide.
| Compound Name | N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-2-nitrobenzamide |
|---|---|
| PubChem CID | 18112696 |
| Molecular Formula | C16H14FN3O4 |
| Molecular Weight | 331.30 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[2-(4-fluoroanilino)-2-oxoethyl]-N-methyl-2-nitrobenzamide |
| SMILES | CN(CC(=O)Nc1ccc(F)cc1)C(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14FN3O4/c1-19(10-15(21)18-12-8-6-11(17)7-9-12)16(22)13-4-2-3-5-14(13)20(23)24/h2-9H,10H2,1H3,(H,18,21) |
| InChIKey | FHOGUHOFOOOJGB-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|