C18H19N3O4 — CID 26863291
N,2-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-3-nitrobenzamide (PubChem CID 26863291) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is N,2-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-3-nitrobenzamide.
| Compound Name | N,2-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 26863291 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | N,2-dimethyl-N-[2-(4-methylanilino)-2-oxoethyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(NC(=O)CN(C)C(=O)c2cccc([N+](=O)[O-])c2C)cc1 |
| InChI | InChI=1S/C18H19N3O4/c1-12-7-9-14(10-8-12)19-17(22)11-20(3)18(23)15-5-4-6-16(13(15)2)21(24)25/h4-10H,11H2,1-3H3,(H,19,22) |
| InChIKey | KGFGMNWVMHEIEO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|