C17H16FN3O4 — CID 9439693
N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(2-nitrophenyl)acetamide (PubChem CID 9439693) has the molecular formula C17H16FN3O4 and a molecular weight of 345.33 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(2-nitrophenyl)acetamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 9439693 |
| Molecular Formula | C17H16FN3O4 |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-2-(2-nitrophenyl)acetamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16FN3O4/c1-20(11-16(22)19-14-7-4-6-13(18)10-14)17(23)9-12-5-2-3-8-15(12)21(24)25/h2-8,10H,9,11H2,1H3,(H,19,22) |
| InChIKey | XCRPOWDHRMOFEO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|