C15H21FN2O2 — CID 17393016
N-[2-(3-fluoroanilino)-2-oxoethyl]-N,3,3-trimethylbutanamide (PubChem CID 17393016) has the molecular formula C15H21FN2O2 and a molecular weight of 280.34 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-N,3,3-trimethylbutanamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 17393016 |
| Molecular Formula | C15H21FN2O2 |
| Molecular Weight | 280.34 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N,3,3-trimethylbutanamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C15H21FN2O2/c1-15(2,3)9-14(20)18(4)10-13(19)17-12-7-5-6-11(16)8-12/h5-8H,9-10H2,1-4H3,(H,17,19) |
| InChIKey | KYDHXXLNACCPSS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |