C16H13F3N2O2 — CID 9439130
3,5-difluoro-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbenzamide (PubChem CID 9439130) has the molecular formula C16H13F3N2O2 and a molecular weight of 322.29 g/mol. Its IUPAC name is 3,5-difluoro-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbenzamide.
| Compound Name | 3,5-difluoro-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 9439130 |
| Molecular Formula | C16H13F3N2O2 |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 3,5-difluoro-N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C16H13F3N2O2/c1-21(16(23)10-5-12(18)7-13(19)6-10)9-15(22)20-14-4-2-3-11(17)8-14/h2-8H,9H2,1H3,(H,20,22) |
| InChIKey | NBZHLWCUOPWLSC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |