C16H14FIN2O2 — CID 27794667
N-[2-(3-fluoroanilino)-2-oxoethyl]-2-iodo-N-methylbenzamide (PubChem CID 27794667) has the molecular formula C16H14FIN2O2 and a molecular weight of 412.20 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-2-iodo-N-methylbenzamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-2-iodo-N-methylbenzamide |
|---|---|
| PubChem CID | 27794667 |
| Molecular Formula | C16H14FIN2O2 |
| Molecular Weight | 412.20 g/mol |
| Exact Mass | 412.01 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-2-iodo-N-methylbenzamide |
| SMILES | CN(CC(=O)Nc1cccc(F)c1)C(=O)c1ccccc1I |
| InChI | InChI=1S/C16H14FIN2O2/c1-20(16(22)13-7-2-3-8-14(13)18)10-15(21)19-12-6-4-5-11(17)9-12/h2-9H,10H2,1H3,(H,19,21) |
| InChIKey | WEIWCDUKBOPMNM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.20 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|