C19H22FN3O4S — CID 9439272
N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 9439272) has the molecular formula C19H22FN3O4S and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 9439272 |
| Molecular Formula | C19H22FN3O4S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | N-[2-(3-fluoroanilino)-2-oxoethyl]-N-methyl-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC(C)NS(=O)(=O)c1cccc(C(=O)N(C)CC(=O)Nc2cccc(F)c2)c1 |
| InChI | InChI=1S/C19H22FN3O4S/c1-13(2)22-28(26,27)17-9-4-6-14(10-17)19(25)23(3)12-18(24)21-16-8-5-7-15(20)11-16/h4-11,13,22H,12H2,1-3H3,(H,21,24) |
| InChIKey | SHLIRQIXBUMGHO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |