C10H10Cl2N2O2 — CID 115192019
N'-[(3,4-dichlorophenyl)methyl]-N'-methyloxamide (PubChem CID 115192019) has the molecular formula C10H10Cl2N2O2 and a molecular weight of 261.11 g/mol. Its IUPAC name is N'-[(3,4-dichlorophenyl)methyl]-N'-methyloxamide.
| Compound Name | N'-[(3,4-dichlorophenyl)methyl]-N'-methyloxamide |
|---|---|
| PubChem CID | 115192019 |
| Molecular Formula | C10H10Cl2N2O2 |
| Molecular Weight | 261.11 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | N'-[(3,4-dichlorophenyl)methyl]-N'-methyloxamide |
| SMILES | CN(Cc1ccc(Cl)c(Cl)c1)C(=O)C(N)=O |
| InChI | InChI=1S/C10H10Cl2N2O2/c1-14(10(16)9(13)15)5-6-2-3-7(11)8(12)4-6/h2-4H,5H2,1H3,(H2,13,15) |
| InChIKey | KKQWKMGVOWIYMJ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.11 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|