C14H20Cl2N2O — CID 61174614
(2S)-2-amino-N-[(3,4-dichlorophenyl)methyl]-N,3-dimethylpentanamide (PubChem CID 61174614) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is (2S)-2-amino-N-[(3,4-dichlorophenyl)methyl]-N,3-dimethylpentanamide.
| Compound Name | (2S)-2-amino-N-[(3,4-dichlorophenyl)methyl]-N,3-dimethylpentanamide |
|---|---|
| PubChem CID | 61174614 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (2S)-2-amino-N-[(3,4-dichlorophenyl)methyl]-N,3-dimethylpentanamide |
| SMILES | CCC(C)[C@H](N)C(=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H20Cl2N2O/c1-4-9(2)13(17)14(19)18(3)8-10-5-6-11(15)12(16)7-10/h5-7,9,13H,4,8,17H2,1-3H3/t9?,13-/m0/s1 |
| InChIKey | XYQXWFHJXPXWLW-NCWAPJAISA-N |
| XLogP | 3.33 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |