C14H19Cl2NO — CID 112792521
N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylpentanamide (PubChem CID 112792521) has the molecular formula C14H19Cl2NO and a molecular weight of 288.22 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylpentanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylpentanamide |
|---|---|
| PubChem CID | 112792521 |
| Molecular Formula | C14H19Cl2NO |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 287.08 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N,2-dimethylpentanamide |
| SMILES | CCCC(C)C(=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H19Cl2NO/c1-4-5-10(2)14(18)17(3)9-11-6-7-12(15)13(16)8-11/h6-8,10H,4-5,9H2,1-3H3 |
| InChIKey | BJTPTURTTIQELR-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |