C11H12Cl3NO — CID 43167904
2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylpropanamide (PubChem CID 43167904) has the molecular formula C11H12Cl3NO and a molecular weight of 280.58 g/mol. Its IUPAC name is 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylpropanamide.
| Compound Name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylpropanamide |
|---|---|
| PubChem CID | 43167904 |
| Molecular Formula | C11H12Cl3NO |
| Molecular Weight | 280.58 g/mol |
| Exact Mass | 279.00 |
| IUPAC Name | 2-chloro-N-[(3,4-dichlorophenyl)methyl]-N-methylpropanamide |
| SMILES | CC(Cl)C(=O)N(C)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H12Cl3NO/c1-7(12)11(16)15(2)6-8-3-4-9(13)10(14)5-8/h3-5,7H,6H2,1-2H3 |
| InChIKey | DFNYBVYCAFFPRV-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.58 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|