C15H20Cl2INO — CID 142120865
N-[(3,4-dichlorophenyl)methyl]-N-heptan-2-ylcarbamoyl iodide (PubChem CID 142120865) has the molecular formula C15H20Cl2INO and a molecular weight of 428.14 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-heptan-2-ylcarbamoyl iodide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-heptan-2-ylcarbamoyl iodide |
|---|---|
| PubChem CID | 142120865 |
| Molecular Formula | C15H20Cl2INO |
| Molecular Weight | 428.14 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-heptan-2-ylcarbamoyl iodide |
| SMILES | CCCCCC(C)N(Cc1ccc(Cl)c(Cl)c1)C(=O)I |
| InChI | InChI=1S/C15H20Cl2INO/c1-3-4-5-6-11(2)19(15(18)20)10-12-7-8-13(16)14(17)9-12/h7-9,11H,3-6,10H2,1-2H3 |
| InChIKey | STPZLZWMCGWPFP-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.14 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|