C18H27Cl2NO — CID 150273254
N-[(3,4-dichlorophenyl)methyl]-2-ethylnonanamide (PubChem CID 150273254) has the molecular formula C18H27Cl2NO and a molecular weight of 344.33 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-2-ethylnonanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-2-ethylnonanamide |
|---|---|
| PubChem CID | 150273254 |
| Molecular Formula | C18H27Cl2NO |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-2-ethylnonanamide |
| SMILES | CCCCCCCC(CC)C(=O)NCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H27Cl2NO/c1-3-5-6-7-8-9-15(4-2)18(22)21-13-14-10-11-16(19)17(20)12-14/h10-12,15H,3-9,13H2,1-2H3,(H,21,22) |
| InChIKey | GEAAUBQNEAPYQF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|