C19H29NO — CID 90266134
(E)-2-ethyl-N-[(4-methylphenyl)methyl]non-7-enamide (PubChem CID 90266134) has the molecular formula C19H29NO and a molecular weight of 287.45 g/mol. Its IUPAC name is (E)-2-ethyl-N-[(4-methylphenyl)methyl]non-7-enamide.
| Compound Name | (E)-2-ethyl-N-[(4-methylphenyl)methyl]non-7-enamide |
|---|---|
| PubChem CID | 90266134 |
| Molecular Formula | C19H29NO |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (E)-2-ethyl-N-[(4-methylphenyl)methyl]non-7-enamide |
| SMILES | C/C=C/CCCCC(CC)C(=O)NCc1ccc(C)cc1 |
| InChI | InChI=1S/C19H29NO/c1-4-6-7-8-9-10-18(5-2)19(21)20-15-17-13-11-16(3)12-14-17/h4,6,11-14,18H,5,7-10,15H2,1-3H3,(H,20,21)/b6-4+ |
| InChIKey | NWAYNAXEZBWRSF-GQCTYLIASA-N |
| XLogP | 4.77 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|