C19H29NO2 — CID 90266203
(E)-2-ethyl-N-[(4-methoxyphenyl)methyl]non-7-enamide (PubChem CID 90266203) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (E)-2-ethyl-N-[(4-methoxyphenyl)methyl]non-7-enamide.
| Compound Name | (E)-2-ethyl-N-[(4-methoxyphenyl)methyl]non-7-enamide |
|---|---|
| PubChem CID | 90266203 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (E)-2-ethyl-N-[(4-methoxyphenyl)methyl]non-7-enamide |
| SMILES | C/C=C/CCCCC(CC)C(=O)NCc1ccc(OC)cc1 |
| InChI | InChI=1S/C19H29NO2/c1-4-6-7-8-9-10-17(5-2)19(21)20-15-16-11-13-18(22-3)14-12-16/h4,6,11-14,17H,5,7-10,15H2,1-3H3,(H,20,21)/b6-4+ |
| InChIKey | WJXFCEWCPZTKNS-GQCTYLIASA-N |
| XLogP | 4.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|