C23H29NO — CID 150409330
2-ethyl-N-(4-phenylphenyl)non-7-enamide (PubChem CID 150409330) has the molecular formula C23H29NO and a molecular weight of 335.49 g/mol. Its IUPAC name is 2-ethyl-N-(4-phenylphenyl)non-7-enamide.
| Compound Name | 2-ethyl-N-(4-phenylphenyl)non-7-enamide |
|---|---|
| PubChem CID | 150409330 |
| Molecular Formula | C23H29NO |
| Molecular Weight | 335.49 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 2-ethyl-N-(4-phenylphenyl)non-7-enamide |
| SMILES | CC=CCCCCC(CC)C(=O)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H29NO/c1-3-5-6-7-9-12-19(4-2)23(25)24-22-17-15-21(16-18-22)20-13-10-8-11-14-20/h3,5,8,10-11,13-19H,4,6-7,9,12H2,1-2H3,(H,24,25) |
| InChIKey | HFLJIOSPLFWTPU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|