C18H24F3NO — CID 150634098
2-ethyl-N-[4-(trifluoromethyl)phenyl]non-7-enamide (PubChem CID 150634098) has the molecular formula C18H24F3NO and a molecular weight of 327.39 g/mol. Its IUPAC name is 2-ethyl-N-[4-(trifluoromethyl)phenyl]non-7-enamide.
| Compound Name | 2-ethyl-N-[4-(trifluoromethyl)phenyl]non-7-enamide |
|---|---|
| PubChem CID | 150634098 |
| Molecular Formula | C18H24F3NO |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-ethyl-N-[4-(trifluoromethyl)phenyl]non-7-enamide |
| SMILES | CC=CCCCCC(CC)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H24F3NO/c1-3-5-6-7-8-9-14(4-2)17(23)22-16-12-10-15(11-13-16)18(19,20)21/h3,5,10-14H,4,6-9H2,1-2H3,(H,22,23) |
| InChIKey | IYNBFFPANCEQEG-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|