C27H36F3NO — CID 130441271
(5Z,8Z,11Z,14Z)-N-[4-(trifluoromethyl)phenyl]icosa-5,8,11,14-tetraenamide (PubChem CID 130441271) has the molecular formula C27H36F3NO and a molecular weight of 447.59 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-[4-(trifluoromethyl)phenyl]icosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-[4-(trifluoromethyl)phenyl]icosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 130441271 |
| Molecular Formula | C27H36F3NO |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-[4-(trifluoromethyl)phenyl]icosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C27H36F3NO/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-26(32)31-25-22-20-24(21-23-25)27(28,29)30/h6-7,9-10,12-13,15-16,20-23H,2-5,8,11,14,17-19H2,1H3,(H,31,32)/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | NKHZNKSCDFNWTI-DOFZRALJSA-N |
| XLogP | 8.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|