C31H39F3N2O4 — CID 10196571
2-oxo-2-[[4-[[(E)-tetradec-9-enoyl]amino]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid (PubChem CID 10196571) has the molecular formula C31H39F3N2O4 and a molecular weight of 560.66 g/mol. Its IUPAC name is 2-oxo-2-[[4-[[(E)-tetradec-9-enoyl]amino]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid.
| Compound Name | 2-oxo-2-[[4-[[(E)-tetradec-9-enoyl]amino]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
|---|---|
| PubChem CID | 10196571 |
| Molecular Formula | C31H39F3N2O4 |
| Molecular Weight | 560.66 g/mol |
| Exact Mass | 560.29 |
| IUPAC Name | 2-oxo-2-[[4-[[(E)-tetradec-9-enoyl]amino]phenyl]methyl-[[4-(trifluoromethyl)phenyl]methyl]amino]acetic acid |
| SMILES | CCCC/C=C/CCCCCCCC(=O)Nc1ccc(CN(Cc2ccc(C(F)(F)F)cc2)C(=O)C(=O)O)cc1 |
| InChI | InChI=1S/C31H39F3N2O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-28(37)35-27-20-16-25(17-21-27)23-36(29(38)30(39)40)22-24-14-18-26(19-15-24)31(32,33)34/h5-6,14-21H,2-4,7-13,22-23H2,1H3,(H,35,37)(H,39,40)/b6-5+ |
| InChIKey | JASARRWCYBHOSN-AATRIKPKSA-N |
| XLogP | 7.73 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.66 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|