C16H21F3N2O2 — CID 91365401
N'-[4-(trifluoromethyl)phenyl]nonanediamide (PubChem CID 91365401) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is N'-[4-(trifluoromethyl)phenyl]nonanediamide.
| Compound Name | N'-[4-(trifluoromethyl)phenyl]nonanediamide |
|---|---|
| PubChem CID | 91365401 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | N'-[4-(trifluoromethyl)phenyl]nonanediamide |
| SMILES | NC(=O)CCCCCCCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H21F3N2O2/c17-16(18,19)12-8-10-13(11-9-12)21-15(23)7-5-3-1-2-4-6-14(20)22/h8-11H,1-7H2,(H2,20,22)(H,21,23) |
| InChIKey | YNOAAQBPYKAMFJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|