C16H18ClF3N2O3S — CID 162604191
S-[2-oxo-2-[[6-oxo-6-[4-(trifluoromethyl)anilino]hexyl]amino]ethyl] chloromethanethioate (PubChem CID 162604191) has the molecular formula C16H18ClF3N2O3S and a molecular weight of 410.85 g/mol. Its IUPAC name is S-[2-oxo-2-[[6-oxo-6-[4-(trifluoromethyl)anilino]hexyl]amino]ethyl] chloromethanethioate.
| Compound Name | S-[2-oxo-2-[[6-oxo-6-[4-(trifluoromethyl)anilino]hexyl]amino]ethyl] chloromethanethioate |
|---|---|
| PubChem CID | 162604191 |
| Molecular Formula | C16H18ClF3N2O3S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | S-[2-oxo-2-[[6-oxo-6-[4-(trifluoromethyl)anilino]hexyl]amino]ethyl] chloromethanethioate |
| SMILES | O=C(CSC(=O)Cl)NCCCCCC(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H18ClF3N2O3S/c17-15(25)26-10-14(24)21-9-3-1-2-4-13(23)22-12-7-5-11(6-8-12)16(18,19)20/h5-8H,1-4,9-10H2,(H,21,24)(H,22,23) |
| InChIKey | BWRGLKZORIHJEK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|