C16H20Cl2N2O3S — CID 11618064
S-[2-[[6-(3,4-dichloroanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate (PubChem CID 11618064) has the molecular formula C16H20Cl2N2O3S and a molecular weight of 391.32 g/mol. Its IUPAC name is S-[2-[[6-(3,4-dichloroanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[6-(3,4-dichloroanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11618064 |
| Molecular Formula | C16H20Cl2N2O3S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | S-[2-[[6-(3,4-dichloroanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H20Cl2N2O3S/c1-11(21)24-10-16(23)19-8-4-2-3-5-15(22)20-12-6-7-13(17)14(18)9-12/h6-7,9H,2-5,8,10H2,1H3,(H,19,23)(H,20,22) |
| InChIKey | RWUPAHSPDQSRSI-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|