C18H24N2O4S — CID 11660578
S-[2-[[6-(4-acetylanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate (PubChem CID 11660578) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is S-[2-[[6-(4-acetylanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[6-(4-acetylanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 11660578 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | S-[2-[[6-(4-acetylanilino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCC(=O)Nc1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C18H24N2O4S/c1-13(21)15-7-9-16(10-8-15)20-17(23)6-4-3-5-11-19-18(24)12-25-14(2)22/h7-10H,3-6,11-12H2,1-2H3,(H,19,24)(H,20,23) |
| InChIKey | KXZAKLWTMOBKIL-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|