C18H25NO3S — CID 11645714
S-[2-oxo-2-[(8-oxo-8-phenyloctyl)amino]ethyl] ethanethioate (PubChem CID 11645714) has the molecular formula C18H25NO3S and a molecular weight of 335.47 g/mol. Its IUPAC name is S-[2-oxo-2-[(8-oxo-8-phenyloctyl)amino]ethyl] ethanethioate.
| Compound Name | S-[2-oxo-2-[(8-oxo-8-phenyloctyl)amino]ethyl] ethanethioate |
|---|---|
| PubChem CID | 11645714 |
| Molecular Formula | C18H25NO3S |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | S-[2-oxo-2-[(8-oxo-8-phenyloctyl)amino]ethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H25NO3S/c1-15(20)23-14-18(22)19-13-9-4-2-3-8-12-17(21)16-10-6-5-7-11-16/h5-7,10-11H,2-4,8-9,12-14H2,1H3,(H,19,22) |
| InChIKey | KOCTWLKXYRWPAT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|