C17H25NO3 — CID 108807536
N-(6-hydroxyhexyl)-5-oxo-5-phenylpentanamide (PubChem CID 108807536) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is N-(6-hydroxyhexyl)-5-oxo-5-phenylpentanamide.
| Compound Name | N-(6-hydroxyhexyl)-5-oxo-5-phenylpentanamide |
|---|---|
| PubChem CID | 108807536 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | N-(6-hydroxyhexyl)-5-oxo-5-phenylpentanamide |
| SMILES | O=C(CCCC(=O)c1ccccc1)NCCCCCCO |
| InChI | InChI=1S/C17H25NO3/c19-14-7-2-1-6-13-18-17(21)12-8-11-16(20)15-9-4-3-5-10-15/h3-5,9-10,19H,1-2,6-8,11-14H2,(H,18,21) |
| InChIKey | QCPZFZFZQPZZCT-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|