C19H26N2O3S — CID 58608871
S-[2-[[6-(2,3-dihydro-1H-inden-1-ylamino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate (PubChem CID 58608871) has the molecular formula C19H26N2O3S and a molecular weight of 362.50 g/mol. Its IUPAC name is S-[2-[[6-(2,3-dihydro-1H-inden-1-ylamino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate.
| Compound Name | S-[2-[[6-(2,3-dihydro-1H-inden-1-ylamino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
|---|---|
| PubChem CID | 58608871 |
| Molecular Formula | C19H26N2O3S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | S-[2-[[6-(2,3-dihydro-1H-inden-1-ylamino)-6-oxohexyl]amino]-2-oxoethyl] ethanethioate |
| SMILES | CC(=O)SCC(=O)NCCCCCC(=O)NC1CCc2ccccc21 |
| InChI | InChI=1S/C19H26N2O3S/c1-14(22)25-13-19(24)20-12-6-2-3-9-18(23)21-17-11-10-15-7-4-5-8-16(15)17/h4-5,7-8,17H,2-3,6,9-13H2,1H3,(H,20,24)(H,21,23) |
| InChIKey | HLNZZCFKYAAZLN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|