C14H17NO — CID 100952588
N-[(1R)-2,3-dihydro-1H-inden-1-yl]pent-4-enamide (PubChem CID 100952588) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]pent-4-enamide.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]pent-4-enamide |
|---|---|
| PubChem CID | 100952588 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]pent-4-enamide |
| SMILES | C=CCCC(=O)N[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C14H17NO/c1-2-3-8-14(16)15-13-10-9-11-6-4-5-7-12(11)13/h2,4-7,13H,1,3,8-10H2,(H,15,16)/t13-/m1/s1 |
| InChIKey | RKXSIEIXKMSVPU-CYBMUJFWSA-N |
| XLogP | 2.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|