C12H15NO2 — CID 24895519
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-methoxyacetamide (PubChem CID 24895519) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-methoxyacetamide.
| Compound Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 24895519 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)N[C@@H]1CCc2ccccc21 |
| InChI | InChI=1S/C12H15NO2/c1-15-8-12(14)13-11-7-6-9-4-2-3-5-10(9)11/h2-5,11H,6-8H2,1H3,(H,13,14)/t11-/m1/s1 |
| InChIKey | OUYXALWRELEAFF-LLVKDONJSA-N |
| XLogP | 1.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |