C15H20BrNO — CID 103601650
5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanamide (PubChem CID 103601650) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is 5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanamide.
| Compound Name | 5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanamide |
|---|---|
| PubChem CID | 103601650 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-bromo-N-(1,2,3,4-tetrahydronaphthalen-1-yl)pentanamide |
| SMILES | O=C(CCCCBr)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C15H20BrNO/c16-11-4-3-10-15(18)17-14-9-5-7-12-6-1-2-8-13(12)14/h1-2,6,8,14H,3-5,7,9-11H2,(H,17,18) |
| InChIKey | QYYOOAKHMZJLTC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|