C19H27NO — CID 43835607
3-cyclohexyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide (PubChem CID 43835607) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is 3-cyclohexyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide.
| Compound Name | 3-cyclohexyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
|---|---|
| PubChem CID | 43835607 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | 3-cyclohexyl-N-(1,2,3,4-tetrahydronaphthalen-1-yl)propanamide |
| SMILES | O=C(CCC1CCCCC1)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H27NO/c21-19(14-13-15-7-2-1-3-8-15)20-18-12-6-10-16-9-4-5-11-17(16)18/h4-5,9,11,15,18H,1-3,6-8,10,12-14H2,(H,20,21) |
| InChIKey | DRKPSBFDYZKXBK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |