C23H28N2O5S — CID 24560482
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)hexanamide (PubChem CID 24560482) has the molecular formula C23H28N2O5S and a molecular weight of 444.55 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)hexanamide |
|---|---|
| PubChem CID | 24560482 |
| Molecular Formula | C23H28N2O5S |
| Molecular Weight | 444.55 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(2,3-dihydro-1H-inden-1-yl)hexanamide |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)NC1CCc2ccccc21 |
| InChI | InChI=1S/C23H28N2O5S/c26-23(25-20-11-9-17-6-3-4-7-19(17)20)8-2-1-5-13-24-31(27,28)18-10-12-21-22(16-18)30-15-14-29-21/h3-4,6-7,10,12,16,20,24H,1-2,5,8-9,11,13-15H2,(H,25,26) |
| InChIKey | PNLGFHLMWVHIAL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.55 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|