C17H21N3O5S2 — CID 17435477
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1,3-thiazol-2-yl)hexanamide (PubChem CID 17435477) has the molecular formula C17H21N3O5S2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1,3-thiazol-2-yl)hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1,3-thiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 17435477 |
| Molecular Formula | C17H21N3O5S2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1,3-thiazol-2-yl)hexanamide |
| SMILES | O=C(CCCCCNS(=O)(=O)c1ccc2c(c1)OCCO2)Nc1nccs1 |
| InChI | InChI=1S/C17H21N3O5S2/c21-16(20-17-18-8-11-26-17)4-2-1-3-7-19-27(22,23)13-5-6-14-15(12-13)25-10-9-24-14/h5-6,8,11-12,19H,1-4,7,9-10H2,(H,18,20,21) |
| InChIKey | PSEKRFKUKPPNEW-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|