C18H24N4O5S — CID 24627340
6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1-methylpyrazol-3-yl)hexanamide (PubChem CID 24627340) has the molecular formula C18H24N4O5S and a molecular weight of 408.48 g/mol. Its IUPAC name is 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1-methylpyrazol-3-yl)hexanamide.
| Compound Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1-methylpyrazol-3-yl)hexanamide |
|---|---|
| PubChem CID | 24627340 |
| Molecular Formula | C18H24N4O5S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 6-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonylamino)-N-(1-methylpyrazol-3-yl)hexanamide |
| SMILES | Cn1ccc(NC(=O)CCCCCNS(=O)(=O)c2ccc3c(c2)OCCO3)n1 |
| InChI | InChI=1S/C18H24N4O5S/c1-22-10-8-17(21-22)20-18(23)5-3-2-4-9-19-28(24,25)14-6-7-15-16(13-14)27-12-11-26-15/h6-8,10,13,19H,2-5,9,11-12H2,1H3,(H,20,21,23) |
| InChIKey | BRVSOYVAPKCXAP-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|